A1282812
BOC-L-Methionine , 99% , 2488-15-5
Synonym(s):
N-(tert-Butoxycarbonyl)-L -methionine;Boc-L -methionine;Boc-Met-OH;N-α-t.-Boc-L-methionine
CAS NO.:2488-15-5
Empirical Formula: C10H19NO4S
Molecular Weight: 249.33
MDL number: MFCD00065586
EINECS: 219-639-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB27.20 | In Stock |
|
| 5G | RMB60.00 | In Stock |
|
| 10g | RMB102.40 | In Stock |
|
| 25G | RMB188.00 | In Stock |
|
| 100g | RMB656.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 47-50 °C(lit.) |
| alpha | -23 º (c=1.3, methanol) |
| Boiling point: | 415.5±40.0 °C(Predicted) |
| Density | 1.160±0.06 g/cm3(Predicted) |
| refractive index | -22 ° (C=1.3, AcOH) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | almost transparency in Methanol |
| form | Powder |
| pka | 3.83±0.10(Predicted) |
| color | White to off-white |
| optical activity | [α]20/D 22°, c = 1 in methanol |
| BRN | 1727869 |
| Major Application | peptide synthesis |
| InChI | 1S/C10H19NO4S/c1-10(2,3)15-9(14)11-7(8(12)13)5-6-16-4/h7H,5-6H2,1-4H3,(H,11,14)(H,12,13)/t7-/m0/s1 |
| InChIKey | IMUSLIHRIYOHEV-ZETCQYMHSA-N |
| SMILES | CSCC[C@H](NC(=O)OC(C)(C)C)C(O)=O |
| CAS DataBase Reference | 2488-15-5(CAS DataBase Reference) |
Description and Uses
N-Boc-L-methionine is an N-Boc-protected form of L-Methionine (M260440). L-Methionine is an essential amino acid that is obtained from our diet. L-Methionine can be found in grain legumes (such as lentils), and poultry. L-Methionine’s main function is to act as the primary “Start” sequence on mRNA so that the ribosomes can start translating the mRNA into proteins.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H335 |
| Precautionary statements | P280-P304+P340-P312 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| F | 9-23 |
| HS Code | 2930 90 98 |
| Storage Class | 11 - Combustible Solids |







