A1283312
6-Bromo-2-tetralone , 97% , 4133-35-1
Synonym(s):
6-Bromo-2-tetralone
CAS NO.：4133-35-1
Empirical Formula: C10H9BrO
Molecular Weight: 225.08
MDL number: MFCD00239388
EINECS: 207-216-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB84.80 | In Stock |
|
| 5G | RMB364.80 | In Stock |
|
| 25G | RMB1206.40 | In Stock |
|
| 100g | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 70-76 °C |
| Boiling point: | 319.2±42.0 °C(Predicted) |
| Density | 1.3991 (rough estimate) |
| refractive index | 1.5560 (estimate) |
| storage temp. | 2-8°C |
| form | Crystalline Powder |
| color | Pale yellow to brown |
| InChI | InChI=1S/C10H9BrO/c11-9-3-1-8-6-10(12)4-2-7(8)5-9/h1,3,5H,2,4,6H2 |
| InChIKey | BYHKDUFPSJWJDI-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(Br)C=C2)CCC1=O |
| CAS DataBase Reference | 4133-35-1(CAS DataBase Reference) |
Description and Uses
6-Bromo-2-tetralone is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H315 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29147000 |
