A1284812
Bismarck Brown Y , Biologicalstain , 10114-58-6
Synonym(s):
4,4′-(m-Phenylenebisazo)bis-m-phenylenediamine dihydrochloride;Basic Brown 1;Bismarck Brown B;Vesuvine
CAS NO.:10114-58-6
Empirical Formula: C18H20Cl2N8
Molecular Weight: 419.31
MDL number: MFCD00012977
EINECS: 233-314-3
| Pack Size | Price | Stock | Quantity |
| 25G | RMB27.20 | In Stock |
|
| 100G | RMB66.40 | In Stock |
|
| 500g | RMB303.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >200 ℃ |
| storage temp. | Flammables area |
| solubility | Soluble in water, methyl cellosolve, ethylene
glycol; slightly soluble in ethanol; insoluble in acetone,
benzene, carbon tetrachloride, xylene |
| pka | 5.0(at 25℃) |
| Colour Index | 21000 |
| form | powder |
| color | Blackish-brown or red-brown |
| Water Solubility | Soluble |
| λmax | 457 nm |
| Merck | 14,1253 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, reducing agents. |
| Biological Applications | Differential inhibition of brain specific binding |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C18H18N8.2ClH/c19-11-4-6-17(15(21)8-11)25-23-13-2-1-3-14(10-13)24-26-18-7-5-12(20)9-16(18)22;;/h1-10H,19-22H2;2*1H/b25-23+,26-24+;; |
| InChIKey | MCZVRBLCRZWFJH-SPBSJSFYSA-N |
| SMILES | Cl.Cl.Nc1ccc(\N=N\c2cccc(c2)\N=N\c3ccc(N)cc3N)c(N)c1 |
| CAS DataBase Reference | 10114-58-6(CAS DataBase Reference) |
| EPA Substance Registry System | C.I. Basic Brown 1, dihydrochloride (10114-58-6) |
Description and Uses
Plasma stain for mucins, cartilage and goblet cellsBismarck Brown Y is used for staining mucine, cartilage and goblet cells.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn-F,Xn,F |
| Risk Statements | 20/21/22-11-36/37/38 |
| Safety Statements | 22-24/25-36/37/39-26-16-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 32041300 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |





![2,3,4,5-Tetrahydro-1H-benzo[e][1,4]diazepinedihydrochloride](https://img.chemicalbook.com/CAS/GIF/5177-43-5.gif)
