A1286512
Bis(trimethylsilyl)acetylene , 98% , 14630-40-1
Synonym(s):
BTMSA
CAS NO.:14630-40-1
Empirical Formula: C8H18Si2
Molecular Weight: 170.4
MDL number: MFCD00008276
EINECS: 238-671-9
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB63.20 | In Stock |
|
| 10ML | RMB111.20 | In Stock |
|
| 25ML | RMB199.20 | In Stock |
|
| 50ML | RMB319.20 | In Stock |
|
| 100ML | RMB615.20 | In Stock |
|
| 250ML | RMB1415.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 21-24 °C(lit.) |
| Boiling point: | 136-137 °C(lit.) |
| Density | 0.752 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 29 °C |
| storage temp. | 2-8°C |
| solubility | soluble in Chloroform, Methanol |
| form | liquid |
| color | colorless |
| Specific Gravity | 0.770 |
| Water Solubility | MAY DECOMPOSE |
| Hydrolytic Sensitivity | 2: reacts with aqueous acid |
| BRN | 906870 |
| InChI | 1S/C8H18Si2/c1-9(2,3)7-8-10(4,5)6/h1-6H3 |
| InChIKey | ZDWYFWIBTZJGOR-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#C[Si](C)(C)C |
| CAS DataBase Reference | 14630-40-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Silane, 1,2-ethynediylbis[trimethyl-(14630-40-1) |
| EPA Substance Registry System | Silane, 1,2-ethynediylbis[trimethyl- (14630-40-1) |
Description and Uses
In the presence of CpCo(CO)2 (cat. no. 245259), undergoes cycloaddition with 1,5-hexadiynes to form benzocyclobutenes.1
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xi |
| Risk Statements | 11-36/37/38-10 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| F | 10 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29310095 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |








