A1286812
1,2-Bis(chlorodimethylsilyl)ethane , 96% , 13528-93-3
Synonym(s):
1,1,4,4-Tetramethyl-1,4-dichloro-disilethylene;2,5-Dichloro-2,5-dimethyl-2,5-disilahexane
CAS NO.:13528-93-3
Empirical Formula: C6H16Cl2Si2
Molecular Weight: 215.27
MDL number: MFCD00000505
EINECS: 236-871-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB28.00 | In Stock |
|
| 5G | RMB82.40 | In Stock |
|
| 25G | RMB257.60 | In Stock |
|
| 100G | RMB901.60 | In Stock |
|
| 500G | RMB3999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 35-38 °C (lit.) |
| Boiling point: | 198 °C/734 mmHg (lit.) |
| Density | 0.99 |
| Flash point: | 155 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Low Melting Solid |
| color | Transparent |
| Water Solubility | Reacts with water. |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 1920141 |
| InChI | 1S/C6H16Cl2Si2/c1-9(2,7)5-6-10(3,4)8/h5-6H2,1-4H3 |
| InChIKey | VGQOKOYKFDUPPJ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(Cl)CC[Si](C)(C)Cl |
| CAS DataBase Reference | 13528-93-3(CAS DataBase Reference) |
| EPA Substance Registry System | Silane, 1,2-ethanediylbis[chlorodimethyl- (13528-93-3) |
Description and Uses
1,2-Bis(chlorodimethylsilyl)ethane is used as Protecting Reagent for Primary Amines. It is also used in Medicine field, electronics industry and polymer material.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34-10 |
| Safety Statements | 26-28-36/37/39-45-16 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29319000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |






