A1287912
2-Bromobenzonitrile , 99% , 2042-37-7
CAS NO.:2042-37-7
Empirical Formula: C7H4BrN
Molecular Weight: 182.02
MDL number: MFCD00001772
EINECS: 218-045-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 10g | RMB28.00 | In Stock |
|
| 25G | RMB42.40 | In Stock |
|
| 100G | RMB159.20 | In Stock |
|
| 500G | RMB759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 53-57 °C(lit.) |
| Boiling point: | 251-253 °C(lit.) |
| Density | 1.496 |
| refractive index | 1.5999 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 10.5g/l |
| form | Crystalline Solid |
| color | White to yellow |
| PH | 6.6 (10.5g/l, H2O, 23℃) |
| BRN | 2042185 |
| InChI | InChI=1S/C7H4BrN/c8-7-4-2-1-3-6(7)5-9/h1-4H |
| InChIKey | AFMPMSCZPVNPEM-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=CC=C1Br |
| CAS DataBase Reference | 2042-37-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzonitrile, 2-bromo-(2042-37-7) |
Description and Uses
2-Bromobenzonitrile belongs to a group of ortho-substituted bromobenzenes that have varying hepatotoxicity effects in the presence of rat liver microsomes in vitro. 2-Bromobenzonitrile is also used as a starting material to synthesize novel benzothiophene derivatives that were found to exhibit antibacterial and antifungal activity. It is commonly employed in reactions that require an electron-rich species to carry out nucleophilic substitution (or addition) reactions.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H312-H319-H412 |
| Precautionary statements | P264-P273-P280-P301+P310-P302+P352+P312-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38-20/21/22 |
| Safety Statements | 22-24/25-36/37/39-26 |
| RIDADR | 3276 |
| WGK Germany | 2 |
| RTECS | DI2459750 |
| Hazard Note | Harmful/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269095 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Chronic 3 Eye Irrit. 2 |
| REACH Registrations | Active |







