A1288212
1-Bromo-3,4-(methylenedioxy)benzene , 97% , 2635-13-4
Synonym(s):
4-Bromo-1,2-(methylenedioxy)benzene;5-Bromo-1,3-benzodioxole
CAS NO.:2635-13-4
Empirical Formula: C7H5BrO2
Molecular Weight: 201.02
MDL number: MFCD00005821
EINECS: 220-123-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB42.40 | In Stock |
|
| 100g | RMB130.40 | In Stock |
|
| 500G | RMB596.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 85-86 °C1 mm Hg(lit.) |
| Density | 1.669 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform, Methanol (Sparingly) |
| form | Liquid |
| Specific Gravity | 1.669 |
| color | Clear yellow-orange |
| BRN | 127407 |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C7H5BrO2/c8-5-1-2-6-7(3-5)10-4-9-6/h1-3H,4H2 |
| InChIKey | FBOYMIDCHINJKC-UHFFFAOYSA-N |
| SMILES | O1C2=CC=C(Br)C=C2OC1 |
| CAS DataBase Reference | 2635-13-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Bromo-1,2-(methylenedioxy)benzene(2635-13-4) |
Description and Uses
The coupling of 1-bromo-3,4-(methylenedioxy)benzene with β-methallyl alcohol was catalyzed by Pd(OAc)2 in combination with P(t-Bu)3.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29329990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




