A1289612
1-Bromo-4-chloro-2-nitrobenzene , 99% , 41513-04-6
CAS NO.：41513-04-6
Empirical Formula: C6H3BrClNO2
Molecular Weight: 236.45
MDL number: MFCD00024320
EINECS: 255-421-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.80 | In Stock |
|
| 25G | RMB96.00 | In Stock |
|
| 100G | RMB292.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 67-70 °C(lit.) |
| Boiling point: | 242.5±20.0 °C(Predicted) |
| Density | 2.048 g/mL at 25 °C(lit.) |
| refractive index | 1.6110 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol |
| form | Solid |
| color | Yellow |
| BRN | 1950424 |
| InChI | InChI=1S/C6H3BrClNO2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H |
| InChIKey | UKTIMFAJRPSNGR-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(Cl)C=C1[N+]([O-])=O |
| CAS DataBase Reference | 41513-04-6(CAS DataBase Reference) |
Description and Uses
1-Bromo-4-chloro-2-nitrobenzene may be used in chemical synthesis studies.
Safety
| Symbol(GHS) |   GHS06,GHS07 |
| Signal word | Warning |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P280a-P301+P310a-P405-P501a-P261-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37/39-22 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29049090 |
