PRODUCT Properties
| Melting point: | 31-33 °C (lit.) |
| Boiling point: | 151.5-152.5 °C/14 mmHg (lit.) |
| Density | 1.578 g/mL at 25 °C (lit.) |
| refractive index | 1.5930 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to lump to clear liquid |
| color | White or Colorles to Yellow to Orange |
| Specific Gravity | 1.578 |
| FreezingPoint | 29.0 to 33.0 ℃ |
| Sensitive | Light Sensitive |
| BRN | 1945925 |
| InChI | 1S/C7H6BrNO2/c1-5-2-3-6(8)7(4-5)9(10)11/h2-4H,1H3 |
| InChIKey | UPBUTKQMDPHQAQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Br)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 5326-34-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Bromo-3-nitrotoluene(5326-34-1) |
Description and Uses
4-Bromo-3-nitrotoluene may be used as a starting material in the synthesis of 2-bromo-5-methylaniline and as a reagent in the synthesis of 2-nitro-4:4′-dimethyl-diphenyl by reacting with p-iodotoluene.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22-20/21/22 |
| Safety Statements | 26-36-36/37-36/37/39-22 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29049090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




