A1290412
Baccatin III , Analysis of standard products, ≥99% , 27548-93-2
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB871.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 229-234 °C |
| Boiling point: | 562.81°C (rough estimate) |
| Density | 1.2062 (rough estimate) |
| refractive index | 1.5455-1.5475 |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | DMSO : 125 mg/mL (213.08 mM; Need ultrasonic) |
| pka | 12.76±0.70(Predicted) |
| form | Solid |
| color | White to off-white |
| Water Solubility | insoluble |
| Stability: | 4 Year Shelf Life |
| InChIKey | OVMSOCFBDVBLFW-VHLOTGQHSA-N |
| SMILES | O1C[C@@]2(OC(C)=O)[C@@]3([H])[C@H](OC(=O)C4=CC=CC=C4)[C@@]4(O)C(C)(C)C(=C(C)[C@@H](O)C4)[C@@H](OC(C)=O)C(=O)[C@]3(C)[C@@H](O)C[C@@]12[H] |
| CAS DataBase Reference | 27548-93-2 |
Description and Uses
immunomodulator, induces apoptosis
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H315-H319-H335-H340-H350 |
| Precautionary statements | P201-P202-P261-P302+P352-P305+P351+P338-P308+P313 |
| Hazard Codes | T |
| Risk Statements | 45-46-22-36/37/38-48/20/22 |
| Safety Statements | 53-22-26-36/37/39-45-24/25 |
| RIDADR | 1544 |
| WGK Germany | 3 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29329990 |
