A1291012
Bis(methylglycol) phthalate , 94% , 117-82-8
Synonym(s):
Bis(2-methoxyethyl) phthalate;Dimethylglycol phthalate
CAS NO.：117-82-8
Empirical Formula: C14H18O6
Molecular Weight: 282.29
MDL number: MFCD00042842
EINECS: 204-212-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB33.60 | In Stock |
|
| 25G | RMB72.00 | In Stock |
|
| 100G | RMB205.60 | In Stock |
|
| 500G | RMB448.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -42.4°C |
| Boiling point: | 230 °C10 mm Hg(lit.) |
| Density | 1.173 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | 230°C/10mm |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Liquid |
| color | Colorless |
| Specific Gravity | 1.17 |
| Water Solubility | Soluble in water 8500 mg/L at 25°C. |
| BRN | 2056929 |
| Major Application | cleaning products cosmetics environmental food and beverages personal care |
| InChI | 1S/C14H18O6/c1-17-7-9-19-13(15)11-5-3-4-6-12(11)14(16)20-10-8-18-2/h3-6H,7-10H2,1-2H3 |
| InChIKey | HSUIVCLOAAJSRE-UHFFFAOYSA-N |
| SMILES | COCCOC(=O)c1ccccc1C(=O)OCCOC |
| CAS DataBase Reference | 117-82-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Phthalic acid, di(2-methoxyethyl)ester(117-82-8) |
| EPA Substance Registry System | Bis(2-methoxyethyl) phthalate (117-82-8) |
Description and Uses
Bis(2-methoxyethyl) Phthalate is a phthalate derivative found in cosmetic products.
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Danger |
| Hazard statements | H360 |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T |
| Risk Statements | 61-62 |
| Safety Statements | 53-45 |
| WGK Germany | 3 |
| RTECS | TI1400000 |
| TSCA | TSCA listed |
| HS Code | 29173490 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Repr. 1B |
| Hazardous Substances Data | 117-82-8(Hazardous Substances Data) |
