A1291412
Bentazone solution , analyticalstandard,100ug/mlinAcetone , 25057-89-0
CAS NO.:25057-89-0
Empirical Formula: C10H12N2O3S
Molecular Weight: 240.28
MDL number: MFCD00078640
EINECS: 246-585-8
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB114.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 137-139°C |
| Boiling point: | 395.7±25.0 °C(Predicted) |
| Density | 1.3387 (rough estimate) |
| refractive index | 1.5650 (estimate) |
| Flash point: | 2 °C |
| storage temp. | APPROX 4°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | pKa (24°): 3.3 |
| form | Solid |
| color | White |
| Water Solubility | 0.5g/L(20 ºC) |
| Merck | 13,1051 |
| BRN | 530220 |
| Henry's Law Constant | 4.5×103 mol/(m3Pa) at 25℃, HSDB (2015) |
| Major Application | agriculture environmental |
| InChI | 1S/C10H12N2O3S/c1-7(2)12-10(13)8-5-3-4-6-9(8)11-16(12,14)15/h3-7,11H,1-2H3 |
| InChIKey | ZOMSMJKLGFBRBS-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=O)c2ccccc2NS1(=O)=O |
| NIST Chemistry Reference | Bentazone(25057-89-0) |
| EPA Substance Registry System | Bentazon (25057-89-0) |
Description and Uses
Bentazone is unique under these herbicides because it is the only compound that bears a sulfonyl group. A puzzle that is not solved yet is that bentazone is an excellent herbicide but has a very low pI50-value.
Herbicide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317-H319-H412 |
| Precautionary statements | P261-P273-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,F |
| Risk Statements | 22-36-43-52/53-20/21/22-11 |
| Safety Statements | 2-24-37-61-36-26-16 |
| RIDADR | UN 1648 3/PG 2 |
| WGK Germany | 2 |
| RTECS | DK9900000 |
| TSCA | TSCA listed |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Repr. 2 Skin Sens. 1 |
| Hazardous Substances Data | 25057-89-0(Hazardous Substances Data) |
| Toxicity | LD50 in male, female rats (mg/kg): 383.2, 433.6 orally (Ugazio) |



