A1291912
Butachlor , Analysis standard product, 95% , 23184-66-9
CAS NO.:23184-66-9
Empirical Formula: C17H26ClNO2
Molecular Weight: 311.85
MDL number: MFCD00072426
EINECS: 245-477-8
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB286.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <-5°C |
| Boiling point: | 156°C (0.5 torr) |
| Density | d430 1.0695 |
| refractive index | 1.5388 (estimate) |
| Flash point: | 100 °C |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 1.20±0.50(Predicted) |
| form | Liquid |
| color | Light yellow-purple |
| Water Solubility | 20mg/L(20 ºC) |
| BRN | 2873811 |
| InChI | 1S/C17H26ClNO2/c1-4-7-11-21-13-19(16(20)12-18)17-14(5-2)9-8-10-15(17)6-3/h8-10H,4-7,11-13H2,1-3H3 |
| InChIKey | HKPHPIREJKHECO-UHFFFAOYSA-N |
| SMILES | CCCCOCN(C(=O)CCl)c1c(CC)cccc1CC |
| CAS DataBase Reference | 23184-66-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Butachlor(23184-66-9) |
| EPA Substance Registry System | Butachlor (23184-66-9) |
Description and Uses
Butachlor is a pre-emergent chloroacetanalide herbicide. Butachlor is commonly used for weed control in rice as well as cotton, maize, wheat and other crops.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H410 |
| Precautionary statements | P264-P270-P273-P301+P312-P391-P501 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,N |
| Risk Statements | 22-50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN3082 9/PG 3 |
| WGK Germany | 3 |
| RTECS | AE1200000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 23184-66-9(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: 1740 mg/kg (Strateva) |




