A1292712
Bromopropylate solution , analyticalstandard,1.00mg/mlinmethanol , 18181-80-1
Synonym(s):
Isopropyl 4,4′-dibromobenzilate;Phenisobromolate
CAS NO.:18181-80-1
Empirical Formula: C17H16Br2O3
Molecular Weight: 428.12
MDL number: MFCD00078632
EINECS: 242-070-7
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB86.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 77° |
| Boiling point: | 504°C (rough estimate) |
| Density | 1.5582 (rough estimate) |
| refractive index | 1.6010 (estimate) |
| Flash point: | >100 °C |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 11.18±0.29(Predicted) |
| color | White to Off-White |
| Water Solubility | <0.5mg/L(20 ºC) |
| BRN | 2152560 |
| Major Application | agriculture environmental |
| InChI | 1S/C17H16Br2O3/c1-11(2)22-16(20)17(21,12-3-7-14(18)8-4-12)13-5-9-15(19)10-6-13/h3-11,21H,1-2H3 |
| InChIKey | FOANIXZHAMJWOI-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C(O)(c1ccc(Br)cc1)c2ccc(Br)cc2 |
| CAS DataBase Reference | 18181-80-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Bromopropylate(18181-80-1) |
| EPA Substance Registry System | Bromopropylate (18181-80-1) |
Description and Uses
Bromopropylate is a chemical compound used as an acaricide against spider mites in apiaries and on fruit crops such as citrus and grapes.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 38 |
| WGK Germany | 2 |
| RTECS | DD2100000 |
| HS Code | 29181990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 18181-80-1(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: 5000 mg/kg (Kenaga, Allison) |





