A1293612
Benzo[a]pyrene-d12 , Analysis standard , 63466-71-7
Synonym(s):
3,4-Benzopyrene-d12;Deuterated benzo[a]pyrene
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB2079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 177-180 °C(lit.) |
| Boiling point: | 495 °C(lit.) |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Hexanes (Slightly) |
| form | solid |
| Major Application | electronics |
| InChI | 1S/C20H12/c1-2-7-17-15(4-1)12-16-9-8-13-5-3-6-14-10-11-18(17)20(16)19(13)14/h1-12H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D |
| InChIKey | FMMWHPNWAFZXNH-AQZSQYOVSA-N |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c([2H])c3c([2H])c([2H])c4c([2H])c([2H])c([2H])c5c([2H])c([2H])c2c3c45 |
| EPA Substance Registry System | Benzo[a]pyrene-d12 (63466-71-7) |
Description and Uses
Benzo[a]pyrene-d12 can be used as a stable isotope internal standard for the quantification of benzo(a)pyrene content in specific food samples using gas chromatography/mass spectrometry.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H317-H340-H350-H360FD-H410 |
| Precautionary statements | P201-P202-P273-P280-P302+P352-P308+P313 |
| Hazard Codes | T,N |
| Risk Statements | 45-46-60-61-43-50/53 |
| Safety Statements | 53-45-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| HS Code | 28459000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Carc. 1B Muta. 1B Repr. 1B Skin Sens. 1 |

![Benzo[a]pyrene-d12](https://img.chemicalbook.com/CAS/GIF/63466-71-7.gif)





