A1296512
2-Benzothiazoleacetonitrile , 98% , 56278-50-3
CAS NO.:56278-50-3
Empirical Formula: C9H6N2S
Molecular Weight: 174.22
MDL number: MFCD00051633
EINECS: 627-570-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB101.60 | In Stock |
|
| 5G | RMB269.60 | In Stock |
|
| 25G | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-101 °C (lit.) |
| Boiling point: | 329.6±25.0 °C(Predicted) |
| Density | 1.315±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 0.10±0.10(Predicted) |
| form | solid |
| color | Yellow |
| Water Solubility | Slightly soluble in water. |
| BRN | 128460 |
| InChI | InChI=1S/C9H6N2S/c10-6-5-9-11-7-3-1-2-4-8(7)12-9/h1-4H,5H2 |
| InChIKey | ZMZSYUSDGRJZNT-UHFFFAOYSA-N |
| SMILES | S1C2=CC=CC=C2N=C1CC#N |
| CAS DataBase Reference | 56278-50-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Cyanomethyl-1,3-benzothiazole(56278-50-3) |
Description and Uses
2-Benzothiazoleacetonitrile is used in Organic Synthesis, Pharmaceuticals, Agrochemicals and Dye stuffs.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-36/37/39 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2934208090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





