A1297512
4-Bromo-2-fluoroaniline , 98% , 367-24-8
CAS NO.:367-24-8
Empirical Formula: C6H5BrFN
Molecular Weight: 190.01
MDL number: MFCD00010221
EINECS: 206-685-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 10g | RMB23.20 | In Stock |
|
| 25G | RMB34.40 | In Stock |
|
| 100G | RMB128.00 | In Stock |
|
| 500g | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 40-42 °C |
| Boiling point: | 103-108 °C (13 mmHg) |
| Density | 1.6196 (rough estimate) |
| refractive index | 1.4710 (estimate) |
| Flash point: | 220 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 2.50±0.10(Predicted) |
| form | Crystalline Mass, Powder, Crystals and/or Chunks |
| color | Beige to light brown to brown-gray or gray |
| BRN | 2081089 |
| Stability: | Stable. Incompatible with acid chlorides, acid anhydrides, strong acids, strong oxidizing agents. |
| InChI | InChI=1S/C6H5BrFN/c7-4-1-2-6(9)5(8)3-4/h1-3H,9H2 |
| InChIKey | GZRMNMGWNKSANY-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(Br)C=C1F |
| CAS DataBase Reference | 367-24-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Bromo-2-fluoroaniline(367-24-8) |
Description and Uses
4-Bromo-2-fluoroaniline was used in synthesis of 4-amino-3-fluorophenyl boronic acid. It was also used in chemical modification and synthesis of boronic acid derivatives for ultraviolet-visible titration.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,T,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-37/39-36/37/39-36 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





