A1299912
3-Bromo-5-methoxypyridine , 97% , 50720-12-2
CAS NO.:50720-12-2
Empirical Formula: C6H6BrNO
Molecular Weight: 188.02
MDL number: MFCD00234169
EINECS: 629-553-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB27.20 | In Stock |
|
| 1G | RMB47.20 | In Stock |
|
| 100G | RMB792.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 31-35 °C (lit.) |
| Boiling point: | 212.2±20.0 °C(Predicted) |
| Density | 1.530±0.06 g/cm3(Predicted) |
| Flash point: | 215 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| pka | 2.26±0.10(Predicted) |
| form | Low Melting Solid |
| color | White to yellow |
| InChI | InChI=1S/C6H6BrNO/c1-9-6-2-5(7)3-8-4-6/h2-4H,1H3 |
| InChIKey | FZWUIWQMJFAWJW-UHFFFAOYSA-N |
| SMILES | C1=NC=C(OC)C=C1Br |
| CAS DataBase Reference | 50720-12-2(CAS DataBase Reference) |
Description and Uses
3-Bromo-5-methoxypyridine is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P301+P312+P330-P305+P351+P338+P310 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT, IRRITANT-HARMFUL |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |




