A1300012
5-Bromo-2-methoxypyridine , 97% , 13472-85-0
CAS NO.:13472-85-0
Empirical Formula: C6H6BrNO
Molecular Weight: 188.02
MDL number: MFCD01318952
EINECS: 603-856-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB75.20 | In Stock |
|
| 100G | RMB253.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 80 °C/12 mmHg (lit.) |
| Density | 1.453 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 205 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 1.04±0.10(Predicted) |
| form | Liquid |
| Specific Gravity | 1.453 |
| color | Clear colorless to slightly yellow |
| BRN | 115150 |
| InChI | InChI=1S/C6H6BrNO/c1-9-6-3-2-5(7)4-8-6/h2-4H,1H3 |
| InChIKey | XADICJHFELMBGX-UHFFFAOYSA-N |
| SMILES | C1(OC)=NC=C(Br)C=C1 |
| LogP | 0.952 |
| CAS DataBase Reference | 13472-85-0(CAS DataBase Reference) |
Description and Uses
5-Bromo-2-methoxypyridine is used as a ligand for central nicotinic acetylcholine receptor. Also used in a novel synthetic approach to anti-HIV active integrase inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







