A1300612
2-Bromo-4-methylpyridine , 97% , 4926-28-7
CAS NO.:4926-28-7
Empirical Formula: C6H6BrN
Molecular Weight: 172.02
MDL number: MFCD00082590
EINECS: 625-590-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB32.80 | In Stock |
|
| 25G | RMB103.20 | In Stock |
|
| 100G | RMB367.20 | In Stock |
|
| 500g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 87 °C/10 mmHg (lit.) |
| Density | 1.545 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol (Slightly) |
| pka | 1.46±0.10(Predicted) |
| form | Liquid |
| color | Clear yellow |
| Specific Gravity | 1.545 |
| BRN | 107331 |
| InChI | InChI=1S/C6H6BrN/c1-5-2-3-8-6(7)4-5/h2-4H,1H3 |
| InChIKey | LSZMVESSGLHDJE-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=CC(C)=C1 |
| CAS DataBase Reference | 4926-28-7(CAS DataBase Reference) |
Description and Uses
An intermediate of pyridinyl pyrrole compounds as proton pump inhibitors with improved gastric acid secretion suppressive activity
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





