A1300812
1,2-Bis(trimethylsiloxy)ethane , 95% , 7381-30-8
Synonym(s):
Ethylene glycol bis(trimethylsilyl ether)
CAS NO.:7381-30-8
Empirical Formula: C8H22O2Si2
Molecular Weight: 206.43
MDL number: MFCD00009640
EINECS: 230-950-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB59.20 | In Stock |
|
| 25G | RMB205.60 | In Stock |
|
| 100G | RMB712.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 165-166 °C (lit.) |
| Density | 0.842 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 115 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Liquid |
| color | Clear colorless to faint yellow |
| Specific Gravity | 0.842 |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| BRN | 1744217 |
| InChI | InChI=1S/C8H22O2Si2/c1-11(2,3)9-7-8-10-12(4,5)6/h7-8H2,1-6H3 |
| InChIKey | JGWFUSVYECJQDT-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OCCO[Si](C)(C)C |
| CAS DataBase Reference | 7381-30-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,2-Bis(trimethylsiloxy)ethane(7381-30-8) |
Description and Uses
1,2-Bis(trimethylsiloxy)ethane may be used in chemical synthesis studies.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H226 |
| Precautionary statements | P210-P233-P240-P241+P242+P243-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P370+P378-P403+P235-P501-P241-P280a-P303+P361+P353-P501a |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Risk Statements | 10 |
| Safety Statements | 23-24/25-16 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | No |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |





