A1305412
Boc-His(Trt)-OH , 98% , 32926-43-5
Synonym(s):
Nα-Boc-N(im)-trityl-L -histidine;Boc-His(Trt)-OH;N-α-t.-Boc-N-im-trityl-L-histidine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB74.40 | In Stock |
|
| 25G | RMB282.40 | In Stock |
|
| 100G | RMB833.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~130 °C (dec.) |
| alpha | 12.5 º (C=1% IN MEOH) |
| Boiling point: | 667.5±55.0 °C(Predicted) |
| Density | 1.16±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Sparingly) |
| pka | 3.17±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| optical activity | [α]20/D +12.5±1.0°, c = 1% in methanol |
| BRN | 732035 |
| Major Application | peptide synthesis |
| InChIKey | OYXZPXVCRAAKCM-SANMLTNESA-N |
| SMILES | C(O)(=O)[C@H](CC1N=CN(C(C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)C=1)NC(OC(C)(C)C)=O |
| CAS DataBase Reference | 32926-43-5(CAS DataBase Reference) |
Description and Uses
Boc-His(Trt)-OH is a histidine derivative. Its a protected histidine derivative for only the critical coupling step. After coupling the Boc- and Trt-groups are cleaved simultaneously by TFA.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |







