A1307012
Boc-Tyr(tBu)-OH , 99% , 47375-34-8
Synonym(s):
Boc-O-tert-butyl-L -tyrosine;Boc-Tyr(tBu)-OH;N-α-t.-Boc-O-t.-butyl-L-tyrosine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB32.00 | In Stock |
|
| 5G | RMB57.60 | In Stock |
|
| 25G | RMB238.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 113-118 °C |
| Boiling point: | 484.0±40.0 °C(Predicted) |
| alpha | -15 º (C=1% IN DMF) |
| Density | 1.116±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | powder to crystal |
| pka | 3.00±0.10(Predicted) |
| color | White to Almost white |
| optical activity | [α]20/D 15.0±1.0°, c = 1% in DMF |
| Water Solubility | Soluble in DMF. Insoluble in water. |
| BRN | 4327336 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C18H27NO5/c1-17(2,3)23-13-9-7-12(8-10-13)11-14(15(20)21)19-16(22)24-18(4,5)6/h7-10,14H,11H2,1-6H3,(H,19,22)(H,20,21)/t14-/m0/s1 |
| InChIKey | ZEQLLMOXFVKKCN-AWEZNQCLSA-N |
| SMILES | C(O)(=O)[C@H](CC1=CC=C(OC(C)(C)C)C=C1)NC(OC(C)(C)C)=O |
| CAS DataBase Reference | 47375-34-8(CAS DataBase Reference) |
Description and Uses
N-Boc-O-tert-butyl-L-tyrosine (Boc-L-Tyr(tBu)-OH) is used as pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |




