A1308212
N-Boc-3-(3-pyridyl)-L-alanine , 99% , 117142-26-4
Synonym(s):
Boc-β-(3-pyridyl)-Ala-OH;Boc-3-(3-pyridyl)-L -alanine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB263.20 | In Stock |
|
| 5G | RMB959.20 | In Stock |
|
| 25g | RMB3839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 136-142 °C |
| alpha | 15.5 º (c=1% in EtOH) |
| Boiling point: | 409.5°C (rough estimate) |
| Density | 1.1738 (rough estimate) |
| refractive index | 1.6450 (estimate) |
| storage temp. | −20°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pka | 3.43±0.10(Predicted) |
| form | Crystalline Powder |
| color | Off-white to pale yellow |
| optical activity | [α]20/D +15.5±1°, c = 1% in ethanol |
| BRN | 7625087 |
| Major Application | peptide synthesis |
| InChI | InChI=1/C13H18N2O4/c1-13(2,3)19-12(18)15-10(11(16)17)7-9-5-4-6-14-8-9/h4-6,8,10H,7H2,1-3H3,(H,15,18)(H,16,17)/t10-/s3 |
| InChIKey | JLBCSWWZSSVXRQ-JQHDBZEONA-N |
| SMILES | [C@H](C(=O)O)(NC(=O)OC(C)(C)C)CC1=CN=CC=C1 |&1:0,r| |
| CAS DataBase Reference | 117142-26-4(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







