A1308512
Boc-β-Glu(OBzl)-OH , 98% , 254101-10-5
Synonym(s):
Boc-L -β-glutamic acid 5-benzyl ester;Boc-L -β-homoaspartic acid 5-benzyl ester
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB122.40 | In Stock |
|
| 250mg | RMB201.60 | In Stock |
|
| 1G | RMB510.40 | In Stock |
|
| 5G | RMB1500.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| color | White to off-white |
| BRN | 8430789 |
| Major Application | peptide synthesis |
| InChI | 1S/C17H23NO6/c1-17(2,3)24-16(22)18-13(9-14(19)20)10-15(21)23-11-12-7-5-4-6-8-12/h4-8,13H,9-11H2,1-3H3,(H,18,22)(H,19,20)/t13-/m1/s1 |
| InChIKey | FAFJSSKTLCNWRJ-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(O)=O)CC(=O)OCc1ccccc1 |
| CAS DataBase Reference | 254101-10-5(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
