A1309750
3-Isobutylglutarimid , 98% , 916982-10-0
CAS NO.:916982-10-0
Empirical Formula: C9H15NO2
Molecular Weight: 169.22
MDL number: MFCD18277013
EINECS: 200-582-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB69.60 | In Stock |
|
| 25g | RMB196.00 | In Stock |
|
| 100g | RMB487.20 | In Stock |
|
| 500g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 136-138℃ |
| Boiling point: | 305℃ |
| Density | 1.016 |
| Flash point: | 131℃ |
| storage temp. | Refrigerator |
| solubility | Chloroform (Sparingly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 11.78±0.40(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C9H15NO2/c1-6(2)3-7-4-8(11)10-9(12)5-7/h6-7H,3-5H2,1-2H3,(H,10,11,12) |
| InChIKey | FNAQPQLVCOZGRH-UHFFFAOYSA-N |
| SMILES | N1C(=O)CC(CC(C)C)CC1=O |
Description and Uses
4-(2-Methylpropyl)piperidine-2,6-dione can be used to synthesize gabapentin via Hofmann-type rearrangement. Gabapentin (G117250) is an amino acid structurally related toγ-Aminobutyric Acid (GABA) that can cross the blood brain barrier. Gabapentin is used as an anticonvulsant.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P332+P313-P337+P313-P362-P403+P233-P405-P501 |




