A1311512
BOC-D-Prolinol , 98% , 83435-58-9
Synonym(s):
(R)-(+)-1-(tert-Butoxycarbonyl)-2-pyrrolidinemethanol;N-t-Boc-D -prolinol;N-Boc-D -prolinol
CAS NO.：83435-58-9
Empirical Formula: C10H19NO3
Molecular Weight: 201.26
MDL number: MFCD00040580
EINECS: 626-169-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB43.20 | In Stock |
|
| 25G | RMB156.00 | In Stock |
|
| 100g | RMB556.00 | In Stock |
|
| 500g | RMB2652.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60-64 °C (lit.) |
| alpha | 49 º (589nm, =1.3, CHCl3) |
| Boiling point: | 289.5±13.0 °C(Predicted) |
| Density | 1.084±0.06 g/cm3(Predicted) |
| refractive index | 54 ° (C=5, MeOH) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 14.77±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to light beige |
| optical activity | [α]23/D +50°, c = 1.3 in chloroform |
| Water Solubility | insoluble |
| InChI | InChI=1S/C10H19NO3/c1-10(2,3)14-9(13)11-6-4-5-8(11)7-12/h8,12H,4-7H2,1-3H3/t8-/m1/s1 |
| InChIKey | BFFLLBPMZCIGRM-MRVPVSSYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC[C@@H]1CO |
| CAS DataBase Reference | 83435-58-9(CAS DataBase Reference) |
Description and Uses
N-(tert-Butoxycarbonyl)-D-prolinol is used to prepare (azetidinyl)methoxy]pyridines and 2-(aryloxymethyl) azacyclic analogs with therapeutic potetials for the treatment of central nervous system (CNS) disorders.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29051990 |
