A1321212
6-Bromo-2H-1,4-benzoxazin-3(4H)-one , 97% , 24036-52-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB59.20 | In Stock |
|
| 5G | RMB172.00 | In Stock |
|
| 25G | RMB688.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 220-225 °C |
| Boiling point: | 376.8±42.0 °C(Predicted) |
| Density | 1.676 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol |
| pka | 11.89±0.20(Predicted) |
| form | Solid |
| color | Light Brown |
| InChI | InChI=1S/C8H6BrNO2/c9-5-1-2-7-6(3-5)10-8(11)4-12-7/h1-3H,4H2,(H,10,11) |
| InChIKey | UQCFMEFQBSYDHY-UHFFFAOYSA-N |
| SMILES | O1C2=CC=C(Br)C=C2NC(=O)C1 |
Description and Uses
6-Bromo-2H-1,4-benzoxazin-3(4H)-one is used in the synthesis of substituted benzoxazinones; selective 5-HT6 antagonists used for treating central nervous system diseases and gastrointestinal tract disorders.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| HS Code | 2934999090 |
