A1322312
1-Boc-piperidine-3-carbonitrile , 96% , 91419-53-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB32.80 | In Stock |
|
| 5G | RMB142.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60-65℃ |
| Boiling point: | 40°C/30mmHg(lit.) |
| Density | 1.07±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| pka | -3.42±0.40(Predicted) |
| form | Powder |
| color | White to yellow |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C11H18N2O2/c1-11(2,3)15-10(14)13-6-4-5-9(7-12)8-13/h9H,4-6,8H2,1-3H3 |
| InChIKey | UEFZTXGFHKPSFS-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCCC(C#N)C1 |
| CAS DataBase Reference | 91419-53-3(CAS DataBase Reference) |
Description and Uses
N-Boc-3-Cyanopiperidine is an intermediate used to prepare inhibitors of aurora kinases based on the imidazo-[1,2-a]-Pyrazine core.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335-H400 |
| Precautionary statements | P273-P301+P312+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xn,N |
| Risk Statements | 22-36/37/38-50 |
| Safety Statements | 26-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
