A1322712
1-Boc-3-azetidinone , 97% , 398489-26-4
Synonym(s):
tert-Butyl-3-oxoazetidine-1-carboxylate
CAS NO.:398489-26-4
Empirical Formula: C8H13NO3
Molecular Weight: 171.19
MDL number: MFCD01861741
EINECS: 627-725-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 250MG | RMB23.20 | In Stock |
|
| 5G | RMB54.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 47-51 °C |
| Boiling point: | 251.3±33.0 °C(Predicted) |
| Density | 1.174±0.06 g/cm3(Predicted) |
| Flash point: | 102 °C |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Sparingly), Dichloromethane (Slightly) |
| pka | -1.99±0.20(Predicted) |
| form | Crystalline Powder |
| color | White to off-white |
| Sensitive | Moisture Sensitive/Stench |
| InChI | InChI=1S/C8H13NO3/c1-8(2,3)12-7(11)9-4-6(10)5-9/h4-5H2,1-3H3 |
| InChIKey | VMKIXWAFFVLJCK-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CC(=O)C1 |
| CAS DataBase Reference | 398489-26-4(CAS DataBase Reference) |
Description and Uses
1-Boc-3-azetidinone can be used for the preparation of antibacterial aminoglycoside analogs.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-39 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |






![Methyl 8-azabicyclo[3.2.1]octane-3-carboxylate hydrochloride](https://img.chemicalbook.com/CAS/GIF/179022-43-6.gif)

