A1322812
N-Boc-3-pyrrolidinone , 97% , 101385-93-7
Synonym(s):
N-(tert-Butoxycarbonyl)-3-pyrrolidinone
CAS NO.:101385-93-7
Empirical Formula: C9H15NO3
Molecular Weight: 185.22
MDL number: MFCD01631194
EINECS: 600-204-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB28.80 | In Stock |
|
| 10G | RMB49.60 | In Stock |
|
| 25G | RMB110.40 | In Stock |
|
| 100G | RMB415.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 34-38 °C (lit.) |
| Boiling point: | 270.9±33.0 °C(Predicted) |
| Density | 1.133±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Dichloromethane, Ethyl Acetate, Methanol |
| pka | -1.79±0.20(Predicted) |
| form | Low Melting Solid |
| color | White to yellow to orange |
| Water Solubility | Insoluble in water. |
| InChI | InChI=1S/C9H15NO3/c1-9(2,3)13-8(12)10-5-4-7(11)6-10/h4-6H2,1-3H3 |
| InChIKey | JSOMVCDXPUXKIC-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC(=O)C1 |
| CAS DataBase Reference | 101385-93-7(CAS DataBase Reference) |
Description and Uses
N-Boc-3-pyrrolidinone is an organic compound insoluble in water. It is a starting material for the synthesis of spirocyclic tetrahydrofuran and is also used in studies related to the preparation of 5-membered heterocyclic secondary alcohols with carrot as a biocatalyst[1].
Used in a study of asymmetric hydrogen-transfer bioreduction of ketones with Leifsonia alcohol dehydrogenase.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-37/38-41-36/37/38-20/21/22 |
| Safety Statements | 26-36/37/39-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29339900 |








