A1323012
N-Benzyl-3-hydroxypiperidine , 99% , 14813-01-5
Synonym(s):
1-(Phenylmethyl)-3-piperidinol;1-Benzyl-3-hydroxypiperidine
CAS NO.:14813-01-5
Empirical Formula: C12H17NO
Molecular Weight: 191.27
MDL number: MFCD00023734
EINECS: 238-881-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB48.00 | In Stock |
|
| 5G | RMB135.20 | In Stock |
|
| 25G | RMB396.00 | In Stock |
|
| 100G | RMB1030.40 | In Stock |
|
| 500g | RMB4055.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 140-142°C 6mm |
| Density | 1,056 g/cm3 |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 14.82±0.20(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow |
| Sensitive | Hygroscopic |
| BRN | 135964 |
| InChI | InChI=1S/C12H17NO/c14-12-7-4-8-13(10-12)9-11-5-2-1-3-6-11/h1-3,5-6,12,14H,4,7-10H2 |
| InChIKey | UTTCOAGPVHRUFO-UHFFFAOYSA-N |
| SMILES | N1(CC2=CC=CC=C2)CCCC(O)C1 |
| CAS DataBase Reference | 14813-01-5(CAS DataBase Reference) |
Description and Uses
Reactant for bioresolution of tertiary amino ester protic ionic liquids using subtilisin
Reactant for synthesis of:
- Muscarinic M3 selective antagonists
- Rho kinase inhibitors
- Piperidine derivatives for investigations into α-adrenoreceptor direct activation
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | T |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 26-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 2 |
| HS Code | 29333990 |







