A1325512
Benzyl (R)-(-)-glycidyl ether , 99% , 14618-80-5
Synonym(s):
(R)-(−)-2-(Benzyloxymethyl)oxirane;Greatcell Solar;TiO2 paste
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB111.20 | In Stock |
|
| 100G | RMB375.20 | In Stock |
|
| 500g | RMB1574.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 88-93°C |
| Boiling point: | 130 °C (0.1 mmHg) |
| alpha | -5.4 º (c=5 in toluene) |
| Density | 1.077 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| form | paste (yellow) |
| Specific Gravity | 1.077 |
| color | Colorless to Almost colorless |
| optical activity | [α]20/D 5.4°, c = 5 in toluene |
| Water Solubility | Soluble in water. |
| BRN | 3588399 |
| InChI | InChI=1S/C10H12O2/c1-2-4-9(5-3-1)6-11-7-10-8-12-10/h1-5,10H,6-8H2/t10-/m0/s1 |
| InChIKey | QNYBOILAKBSWFG-JTQLQIEISA-N |
| SMILES | O1C[C@@H]1COCC1=CC=CC=C1 |
| CAS DataBase Reference | 14618-80-5(CAS DataBase Reference) |
Description and Uses
Used in the preparation of the lactone fragment of compactin and mevinolin. Chiron in the preparation of syn-1,3-polyols, dideoxynucleosides, and a spiroacetal cyanohydrin.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| RTECS | TX2860020 |
| HS Code | 29109000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | mic-sat 660 nmol/plate MUREAV 298,197,1993 |
| REACH Registrations | Active |





