A1326812
6-Bromo-4-chromanone , Reagent level , 49660-57-3
Synonym(s):
6-Bromo-2,3-dihydro-4H-chromen-4-one
CAS NO.:49660-57-3
Empirical Formula: C9H7BrO2
Molecular Weight: 227.05
MDL number: MFCD00546803
EINECS: 663-717-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB25.60 | In Stock |
|
| 1G | RMB38.40 | In Stock |
|
| 5g | RMB76.80 | In Stock |
|
| 25g | RMB256.80 | In Stock |
|
| 10g | RMB316.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 77-83°C |
| Boiling point: | 336.6±42.0 °C(Predicted) |
| Density | 1.621±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Orange to Green |
| InChI | InChI=1S/C9H7BrO2/c10-6-1-2-9-7(5-6)8(11)3-4-12-9/h1-2,5H,3-4H2 |
| InChIKey | PFLPVOXSUCCZDH-UHFFFAOYSA-N |
| SMILES | C1OC2=CC=C(Br)C=C2C(=O)C1 |
| CAS DataBase Reference | 49660-57-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| HS Code | 2914390090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |






