A1329112
2-Bromopropionyl chloride , 98% , 7148-74-5
CAS NO.:7148-74-5
Empirical Formula: C3H4BrClO
Molecular Weight: 171.42
MDL number: MFCD00000711
EINECS: 230-466-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB43.20 | In Stock |
|
| 10G | RMB71.20 | In Stock |
|
| 50G | RMB209.60 | In Stock |
|
| 100g | RMB415.20 | In Stock |
|
| 250G | RMB696.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 131-133 °C (lit.) |
| Density | 1.7 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 125 °F |
| storage temp. | Store at RT. |
| form | Liquid |
| color | Clear yellow |
| Water Solubility | REACTS |
| BRN | 773800 |
| InChI | InChI=1S/C3H4BrClO/c1-2(4)3(5)6/h2H,1H3 |
| InChIKey | OZGMODDEIHYPRY-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C(Br)C |
| CAS DataBase Reference | 7148-74-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Bromopropionyl chloride(7148-74-5) |
Description and Uses
2-Bromopropionyl chloride was used to synthesize cellulose macroinitiator for homogeneous atom transfer radical polymerization. It was used in the synthesis of 2-aminopropionyl polystyrene resin by Friedel Crafts reaction.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H290-H318-H226-H314-H335 |
| Precautionary statements | P210-P233-P234-P240-P241+P242+P243-P260-P264-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P370+P378-P390-P403+P235-P405-P406-P501-P261-P280-P305+P351+P338-P310-P260h-P303+P361+P353-P501a |
| target organs | Respiratory system |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 10-34-36/37 |
| Safety Statements | 16-26-27-36/37/39-45-25 |
| RIDADR | UN 2920 8/PG 2 |
| WGK Germany | 3 |
| F | 9-21 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29159000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Dam. 1 Flam. Liq. 3 Skin Corr. 1B STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





