A1329612
5-Bromo-2-hydroxynicotinic Acid , 98% , 104612-36-4
CAS NO.：104612-36-4
Empirical Formula: C6H4BrNO3
Molecular Weight: 218
MDL number: MFCD07363801
EINECS: 692-269-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB37.60 | In Stock |
|
| 5G | RMB68.80 | In Stock |
|
| 25g | RMB216.80 | In Stock |
|
| 100g | RMB716.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 287°C |
| Boiling point: | 354.7±42.0 °C(Predicted) |
| Density | 2.015±0.06 g/cm3(Predicted) |
| Flash point: | 287°C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 2.09±0.20(Predicted) |
| color | Light orange to Yellow to Green |
| Decomposition | 287 ºC |
| InChI | InChI=1S/C6H4BrNO3/c7-3-1-4(6(10)11)5(9)8-2-3/h1-2H,(H,8,9)(H,10,11) |
| InChIKey | GYXOTADLHQJPIP-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=C(Br)C=C1C(O)=O |
| CAS DataBase Reference | 104612-36-4(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Hazard Note | Irritant/Keep Cold |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
