A1329712
4,4-Bis(4-hydroxyphenyl)valeric acid , 98% , 126-00-1
Synonym(s):
Diphenolic acid
CAS NO.:126-00-1
Empirical Formula: C17H18O4
Molecular Weight: 286.32
MDL number: MFCD00002800
EINECS: 204-763-2
| Pack Size | Price | Stock | Quantity |
| 25G | RMB41.60 | In Stock |
|
| 100G | RMB120.00 | In Stock |
|
| 500G | RMB398.40 | In Stock |
|
| 2.5kg | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 167-170 °C(lit.) |
| Boiling point: | 388.69°C (rough estimate) |
| Density | 1.30 |
| refractive index | 1.5450 (estimate) |
| Flash point: | 208°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.66±0.10(Predicted) |
| color | White to Off-White |
| Merck | 14,3312 |
| BRN | 1886361 |
| Cosmetics Ingredients Functions | VISCOSITY CONTROLLING |
| InChI | 1S/C17H18O4/c1-17(11-10-16(20)21,12-2-6-14(18)7-3-12)13-4-8-15(19)9-5-13/h2-9,18-19H,10-11H2,1H3,(H,20,21) |
| InChIKey | VKOUCJUTMGHNOR-UHFFFAOYSA-N |
| SMILES | CC(CCC(O)=O)(c1ccc(O)cc1)c2ccc(O)cc2 |
| LogP | 2.890 (est) |
| CAS DataBase Reference | 126-00-1(CAS DataBase Reference) |
| EPA Substance Registry System | Diphenolic acid (126-00-1) |
Description and Uses
Since diphenolic acid is a close structural analog of bisphenol A, diphenolic acid has the potential to displace bisphenol A. A possible endocrine disruptor, bisphenol A is used in polymer applications such as for use in baby bottles, dental resins, and lacquers to coat food cans.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| F | 10 |
| TSCA | TSCA listed |
| HS Code | 29182900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



