A1333212
4-Bromo-3-fluorobenzotrifluoride , 98% , 40161-54-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB43.20 | In Stock |
|
| 25G | RMB175.20 | In Stock |
|
| 100g | RMB695.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 154-155°C |
| Density | 1.72 |
| refractive index | 1.46 |
| Flash point: | 154-155°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| BRN | 2641902 |
| InChI | InChI=1S/C7H3BrF4/c8-5-2-1-4(3-6(5)9)7(10,11)12/h1-3H |
| InChIKey | XCTQZIUCYJVRLJ-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(C(F)(F)F)C=C1F |
| CAS DataBase Reference | 40161-54-4(CAS DataBase Reference) |
Description and Uses
4-BroMo-3-fluorobenzotrifluoride is a useful Laboratory chemical，and it can auses skin irritation and eye irritation.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P210-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P403+P235-P501 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22-51-36-38-37 |
| Safety Statements | 26-36/37/39-36-37 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
