A1333312
4-Bromo-3-nitrobenzotrifluoride , 98% , 349-03-1
CAS NO.:349-03-1
Empirical Formula: C7H3BrF3NO2
Molecular Weight: 270
MDL number: MFCD00014685
EINECS: 670-406-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB28.80 | In Stock |
|
| 25G | RMB99.20 | In Stock |
|
| 100G | RMB341.60 | In Stock |
|
| 500G | RMB1379.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 90 °C (3 mmHg) |
| Density | 1.763 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Light yellow to Amber to Dark green |
| Specific Gravity | 1.763 |
| BRN | 2417762 |
| InChI | 1S/C7H3BrF3NO2/c8-5-2-1-4(7(9,10)11)3-6(5)12(13)14/h1-3H |
| InChIKey | PESPBNYBZVIGRO-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cc(ccc1Br)C(F)(F)F |
| CAS DataBase Reference | 349-03-1(CAS DataBase Reference) |
Description and Uses
4-Bromo-3-nitrobenzotrifluoride may be used to prepare polysubstituted bisheterocycles with potential chemotherapeutic properties.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H302-H312-H332 |
| Precautionary statements | P280h-P305+P351+P338-P337+P313-P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22-36/38 |
| Safety Statements | 36/37/39-26-37/39-36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29049090 |
| Storage Class | 10 - Combustible liquids |




