A1333912
2-Bromomesitylene , 99% , 576-83-0
Synonym(s):
2-Bromo-1,3,5-trimethylbenzene
CAS NO.：576-83-0
Empirical Formula: C9H11Br
Molecular Weight: 199.09
MDL number: MFCD00000073
EINECS: 209-405-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB25.60 | In Stock |
|
| 25G | RMB73.60 | In Stock |
|
| 50g | RMB79.20 | In Stock |
|
| 100G | RMB218.40 | In Stock |
|
| 250g | RMB383.20 | In Stock |
|
| 500G | RMB972.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 2 °C(lit.) |
| Boiling point: | 225 °C(lit.) |
| Density | 1.301 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 205 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| color | Clear colorless to very slightly yellow |
| Water Solubility | Insoluble in water(20°C) . |
| Sensitive | Light Sensitive |
| BRN | 1907245 |
| InChI | InChI=1S/C9H11Br/c1-6-4-7(2)9(10)8(3)5-6/h4-5H,1-3H3 |
| InChIKey | RRTLQRYOJOSPEA-UHFFFAOYSA-N |
| SMILES | C1(C)=CC(C)=CC(C)=C1Br |
| CAS DataBase Reference | 576-83-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 2-bromo-1,3,5-trimethyl-(576-83-0) |
| EPA Substance Registry System | 2-Bromomesitylene (576-83-0) |
Description and Uses
2-Bromomesitylene is a useful synthetic intermediate, Aromatics, Boron Derivatives, Catalyst. It is an intermediate used to prepare Hydrogen[4-[bis(2,4,6-trimethylphenyl)phosphino]-2,3,5,6-tetrafluorophenyl]hydrobis(2,3,4,5,6-pentafluorophenyl)borate (H714510) which is a frustrated phosphonium borate for metal-free catalytic hydrogenation of imines.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-36/37/39-23 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29036990 |
