A1334350
Aluminumtrifluoromethanesulfonate , 98% , 74974-61-1
Synonym(s):
Aluminum triflate;Aluminum tris(trifluoromethanesulfonate);Tris(trifluoromethanesulfonato)aluminum
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5g | RMB55.20 | In Stock |
|
| 25g | RMB151.20 | In Stock |
|
| 100g | RMB592.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 300 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in ether, acetone, acetonitrile, and diglyme; poorly soluble in nitromethane; sparingly soluble in SO2 and SO2 ClF. |
| form | Powder |
| color | White |
| Water Solubility | Insoluble in water. |
| Sensitive | Hygroscopic |
| Hydrolytic Sensitivity | 6: forms irreversible hydrate |
| Stability: | hygroscopic |
| InChI | InChI=1S/CHF3O3S.Al.3H/c2-1(3,4)8(5,6)7;;;;/h(H,5,6,7);;;; |
| InChIKey | GCRKPTQIRSZTMM-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)S(O)(=O)=O.[AlH3] |
| CAS DataBase Reference | 74974-61-1(CAS DataBase Reference) |
Description and Uses
Lewis acid used as a catalyst for Friedel–Crafts, ketalization, nucleophilic substitution, hydroalkoxylation, methoxycarbonyla- tion, rearrangement, and epoxide ring-opening reactions.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,Xi |
| Risk Statements | 34-36/37/38 |
| Safety Statements | 26-36/37/39-45-36 |
| RIDADR | UN 3261 8/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| TSCA | No |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29049020 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





