A1334412
4-Bromo-3,5-dimethylphenol , 99% , 7463-51-6
Synonym(s):
4-Bromo-3,5-xylenol
CAS NO.:7463-51-6
Empirical Formula: C8H9BrO
Molecular Weight: 201.06
MDL number: MFCD00002315
EINECS: 231-255-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB69.60 | In Stock |
|
| 25G | RMB249.60 | In Stock |
|
| 100G | RMB359.20 | In Stock |
|
| 500G | RMB1439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 113-115 °C(lit.) |
| Boiling point: | 195.33°C (rough estimate) |
| Density | 1.3646 (rough estimate) |
| refractive index | 1.5650 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 9+-.0.23(Predicted) |
| form | Crystals or Powder |
| color | Colorless to slightly pink |
| BRN | 2207127 |
| InChI | InChI=1S/C8H9BrO/c1-5-3-7(10)4-6(2)8(5)9/h3-4,10H,1-2H3 |
| InChIKey | WMUWDPLTTLJNPE-UHFFFAOYSA-N |
| SMILES | C1(O)=CC(C)=C(Br)C(C)=C1 |
| CAS DataBase Reference | 7463-51-6(CAS DataBase Reference) |
Description and Uses
4-Bromo-3,5-dimethylphenol is used as a reactant in the synthesis of chromen-4-one and isoflavone scaffolds.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29081990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





