A1334712
1-Bromoadamantane , >97.0%(GC) , 768-90-1
Synonym(s):
1-Adamantyl bromide
CAS NO.:768-90-1
Empirical Formula: C10H15Br
Molecular Weight: 215.13
MDL number: MFCD00074721
EINECS: 212-200-7
| Pack Size | Price | Stock | Quantity |
| 25G | RMB39.20 | In Stock |
|
| 100G | RMB111.20 | In Stock |
|
| 250g | RMB239.20 | In Stock |
|
| 500g | RMB447.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 116-118 °C (lit.) |
| Boiling point: | 248.79°C (rough estimate) |
| Density | 1.2686 (rough estimate) |
| refractive index | 1.6411 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Powder |
| color | White to yellow |
| Water Solubility | It is soluble in organic solvents and insoluble in water. |
| Sensitive | Moisture Sensitive |
| BRN | 1098857 |
| InChI | InChI=1S/C10H15Br/c11-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9H,1-6H2 |
| InChIKey | VQHPRVYDKRESCL-UHFFFAOYSA-N |
| SMILES | C12(Br)CC3CC(CC(C3)C1)C2 |
| CAS DataBase Reference | 768-90-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Bromoadamantane(768-90-1) |
Description and Uses
1-Bromoadamantane is an important intermediate, used in synthesizing medicines and new materials etc.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H332 |
| Precautionary statements | P271-P261-P280 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| F | 8-10-23 |
| HS Code | 29035990 |
| Storage Class | 11 - Combustible Solids |



