A1338612
3-Bromo-2-methylpyridine , 98% , 38749-79-0
Synonym(s):
3-Bromo-2-picoline
CAS NO.:38749-79-0
Empirical Formula: C6H6BrN
Molecular Weight: 172.02
MDL number: MFCD00191224
EINECS: 625-249-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB33.60 | In Stock |
|
| 5G | RMB84.00 | In Stock |
|
| 25G | RMB282.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 76°C/17mm |
| Density | 1.495 |
| refractive index | 1.5604 |
| Flash point: | 174°F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Liquid |
| pka | 3.59±0.10(Predicted) |
| color | Clear, colorless to brown |
| InChI | InChI=1S/C6H6BrN/c1-5-6(7)3-2-4-8-5/h2-4H,1H3 |
| InChIKey | AIPWPTPHMIYYOX-UHFFFAOYSA-N |
| SMILES | C1(C)=NC=CC=C1Br |
| CAS DataBase Reference | 38749-79-0(CAS DataBase Reference) |
Description and Uses
Conversion to the corresponding pyridine carboxaldehyde via peroxide initiated NBS gem-dibromination followed by hydrolysis.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-37/38-41-36/37/38-20/21/22 |
| Safety Statements | 26-36/39-36-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |







