A1339212
4-Bromo-2-fluorobenzyl bromide , 98% , 76283-09-5
Synonym(s):
4,α-Dibromo-2-fluorotoluene
CAS NO.：76283-09-5
Empirical Formula: C7H5Br2F
Molecular Weight: 267.92
MDL number: MFCD00055467
EINECS: 278-412-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB74.40 | In Stock |
|
| 100G | RMB232.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 33-36 °C (lit.) |
| Boiling point: | 126 °C (19 mmHg) |
| Density | 1.9094 (rough estimate) |
| refractive index | 1.5770 (estimate) |
| Flash point: | 126°C/9mm |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| form | Low Melting Solid |
| color | White to off-white |
| Sensitive | Lachrymatory |
| BRN | 4307676 |
| InChI | InChI=1S/C7H5Br2F/c8-4-5-1-2-6(9)3-7(5)10/h1-3H,4H2 |
| InChIKey | XMHNLZXYPAULDF-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC=C(Br)C=C1F |
| CAS DataBase Reference | 76283-09-5(CAS DataBase Reference) |
Description and Uses
4-Bromo-2-fluorobenzyl bromide may be used in the synthesis of 1-(2-fluoro-4-(1-methyl-1H-pyrazol-4-yl)benzyl)indoline-2,3-dione.
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H314-H412 |
| Precautionary statements | P260-P273-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 22-34-52/53-20/21/22 |
| Safety Statements | 26-36/37/39-45-61 |
| RIDADR | UN 2923 8/PG 3 |
| WGK Germany | 2 |
| Hazard Note | Corrosive/Lachrymatory |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29039990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
