A1339912
2-Bromo-6-fluorobenzoic acid , 97% , 2252-37-1
Synonym(s):
6-Bromo-2-fluorobenzoic acid
CAS NO.：2252-37-1
Empirical Formula: C7H4BrFO2
Molecular Weight: 219.01
MDL number: MFCD01569539
EINECS: 207-259-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB61.60 | In Stock |
|
| 25G | RMB237.60 | In Stock |
|
| 100G | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 153-155°C |
| Boiling point: | 286.1±25.0 °C(Predicted) |
| Density | 1.789±0.06 g/cm3(Predicted) |
| refractive index | 1.567-1.569 |
| storage temp. | Sealed in dry,Room Temperature |
| form | Solid |
| pka | 1.92±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C7H4BrFO2/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H,10,11) |
| InChIKey | MDAZJVAIZVUWDE-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=C(F)C=CC=C1Br |
| CAS DataBase Reference | 2252-37-1(CAS DataBase Reference) |
Description and Uses
2-Bromo-6-fluorobenzoic acid is an intermediate, mainly used in the industries such as medicine, agricultural chemicals at present.
Safety
| Symbol(GHS) |   GHS06,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H335-H301-H319 |
| Precautionary statements | P261-P280a-P304+P340-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P301+P310-P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-36-25 |
| Safety Statements | 37/39-26-45 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29163990 |
