A1340712
4-Bromo-3-fluorobenzaldehyde , 97% , 133059-43-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB63.20 | In Stock |
|
| 25G | RMB227.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 55-59 °C |
| Boiling point: | 240.2±25.0 °C(Predicted) |
| Density | 1.670±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Light yellow |
| InChI | InChI=1S/C7H4BrFO/c8-6-2-1-5(4-10)3-7(6)9/h1-4H |
| InChIKey | SWHUROFMIMHWKS-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(Br)C(F)=C1 |
| CAS DataBase Reference | 133059-43-5(CAS DataBase Reference) |
Description and Uses
4-Bromo-3-fluorobenzaldehyde is used in preparation of the Deuterated Dihydropyrimidine compound and their application as anti-HBV agent.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-36-22 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29130000 |
