A1341112
2-Bromo-5-methylpyridine , 98% , 3510-66-5
CAS NO.:3510-66-5
Empirical Formula: C6H6BrN
Molecular Weight: 172.02
MDL number: MFCD00209553
EINECS: 609-062-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB75.20 | In Stock |
|
| 100G | RMB237.60 | In Stock |
|
| 500g | RMB925.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 41-43 °C (lit.) |
| Boiling point: | 95-96 °C/12.5 mmHg (lit.) |
| Density | 1.4964 (rough estimate) |
| refractive index | 1.5680 (estimate) |
| Flash point: | 218 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Dimethyl Sulfoxide, Methanol, |
| pka | 1.08±0.10(Predicted) |
| form | Low Melting Crystalline Solid or Crystals |
| color | White to light yellow or pale brown |
| BRN | 107323 |
| InChI | InChI=1S/C6H6BrN/c1-5-2-3-6(7)8-4-5/h2-4H,1H3 |
| InChIKey | YWNJQQNBJQUKME-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=C(C)C=C1 |
| CAS DataBase Reference | 3510-66-5(CAS DataBase Reference) |
Description and Uses
2-Bromo-5-methylpyridine is used for preparation of [[(triazolylmethyl)pyridyl]phenyl]tetrazoles and related compounds as cardiovascular agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-37/39-36/37/39-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






