A1342612
4-Bromo-3-fluorotoluene , 98% , 452-74-4
CAS NO.:452-74-4
Empirical Formula: C7H6BrF
Molecular Weight: 189.02
MDL number: MFCD00040940
EINECS: 629-423-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB40.80 | In Stock |
|
| 10g | RMB62.40 | In Stock |
|
| 25G | RMB111.20 | In Stock |
|
| 100G | RMB315.20 | In Stock |
|
| 500g | RMB1440.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 95 °C/50 mmHg (lit.) |
| Density | 1.494 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 95 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| Specific Gravity | 1.494 |
| color | Clear light yellow |
| BRN | 2500154 |
| InChI | InChI=1S/C7H6BrF/c1-5-2-3-6(8)7(9)4-5/h2-4H,1H3 |
| InChIKey | SLFNGVGRINFJLK-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(C)C=C1F |
| CAS DataBase Reference | 452-74-4(CAS DataBase Reference) |
Description and Uses
4-Bromo-3-fluorotoluene may be used in the preparation of 1-(4-cyano-3- fluorobenzyl)-5-imidazolecarboxaldehyde and 1-bromo-4-bromomethyl-2-fluorobenzene.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H226-H315-H319-H335 |
| Precautionary statements | P210-P233-P240-P241+P242+P243-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P403+P235-P501-P210e-P280a-P405-P501a-P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 26-37/39-16 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






