A1343012
2-Bromo-4-chloropyridine , 97% , 22918-01-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB35.20 | In Stock |
|
| 5G | RMB97.60 | In Stock |
|
| 25G | RMB365.60 | In Stock |
|
| 100g | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <30℃ |
| Boiling point: | 98°C |
| Density | 1.736±0.06 g/cm3(Predicted) |
| Flash point: | >110℃ |
| storage temp. | -20°C |
| solubility | soluble in Methanol |
| form | powder to lump to clear liquid |
| pka | 0.12±0.10(Predicted) |
| color | White or Colorless to Almost white or Almost colorless |
| InChI | InChI=1S/C5H3BrClN/c6-5-3-4(7)1-2-8-5/h1-3H |
| InChIKey | SURKZMFXICWLHU-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=CC(Cl)=C1 |
| CAS DataBase Reference | 22918-01-0(CAS DataBase Reference) |
Description and Uses
2-Bromo-4-chloropyridine is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-41-37/38-22 |
| Safety Statements | 26-36/37/39-39 |
| WGK Germany | 1 |
| HS Code | 2933399990 |
